About 1-N,2-N-bis(2,6-dimethylphenyl)propane-1,2-diimine
1-N,2-N-bis(2,6-dimethylphenyl)propane-1,2-diimine (PubChem CID 12743350) has the molecular formula C19H22N2
and a molecular weight of 278.40 g/mol. Its IUPAC name is 1-N,2-N-bis(2,6-dimethylphenyl)propane-1,2-diimine.
Molecular Properties
| Compound Name | 1-N,2-N-bis(2,6-dimethylphenyl)propane-1,2-diimine |
| PubChem CID | 12743350 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 1-N,2-N-bis(2,6-dimethylphenyl)propane-1,2-diimine |
| SMILES | CC(/C=N/c1c(C)cccc1C)=N\c1c(C)cccc1C |
| InChI | InChI=1S/C19H22N2/c1-13-8-6-9-14(2)18(13)20-12-17(5)21-19-15(3)10-7-11-16(19)4/h6-12H,1-5H3/b20-12+,21-17+ |
| InChIKey | XUSOVBFGZHNYEX-PPTAUHKUSA-N |
| XLogP | 5.42 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-N,2-N-bis(2,6-dimethylphenyl)propane-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,2-N-bis(2,6-dimethylphenyl)propane-1,2-diimine?
The IUPAC name of 1-N,2-N-bis(2,6-dimethylphenyl)propane-1,2-diimine (CID 12743350) is 1-N,2-N-bis(2,6-dimethylphenyl)propane-1,2-diimine.
What is the SMILES notation for 1-N,2-N-bis(2,6-dimethylphenyl)propane-1,2-diimine?
The canonical SMILES for 1-N,2-N-bis(2,6-dimethylphenyl)propane-1,2-diimine is CC(/C=N/c1c(C)cccc1C)=N\c1c(C)cccc1C.
What is the InChIKey of 1-N,2-N-bis(2,6-dimethylphenyl)propane-1,2-diimine?
The InChIKey is XUSOVBFGZHNYEX-PPTAUHKUSA-N. The full InChI is InChI=1S/C19H22N2/c1-13-8-6-9-14(2)18(13)20-12-17(5)21-19-15(3)10-7-11-16(19)4/h6-12H,1-5H3/b20-12+,21-17+.
What are the key properties of 1-N,2-N-bis(2,6-dimethylphenyl)propane-1,2-diimine?
1-N,2-N-bis(2,6-dimethylphenyl)propane-1,2-diimine has a molecular weight of 278.40 g/mol, XLogP of 5.42, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,2-N-bis(2,6-dimethylphenyl)propane-1,2-diimine is sourced from PubChem (CID 12743350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).