About (1S)-N,N-bis(2-diphenylphosphanylethyl)-1-phenylethanamine
(1S)-N,N-bis(2-diphenylphosphanylethyl)-1-phenylethanamine (PubChem CID 12743567) has the molecular formula C36H37NP2
and a molecular weight of 545.65 g/mol. Its IUPAC name is (1S)-N,N-bis(2-diphenylphosphanylethyl)-1-phenylethanamine.
Molecular Properties
| Compound Name | (1S)-N,N-bis(2-diphenylphosphanylethyl)-1-phenylethanamine |
| PubChem CID | 12743567 |
| Molecular Formula | C36H37NP2 |
| Molecular Weight | 545.65 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | (1S)-N,N-bis(2-diphenylphosphanylethyl)-1-phenylethanamine |
| SMILES | C[C@@H](c1ccccc1)N(CCP(c1ccccc1)c1ccccc1)CCP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H37NP2/c1-31(32-17-7-2-8-18-32)37(27-29-38(33-19-9-3-10-20-33)34-21-11-4-12-22-34)28-30-39(35-23-13-5-14-24-35)36-25-15-6-16-26-36/h2-26,31H,27-30H2,1H3/t31-/m0/s1 |
| InChIKey | ZVNAHLJBPYKGBV-HKBQPEDESA-N |
| XLogP | 7.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 545.65 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (1S)-N,N-bis(2-diphenylphosphanylethyl)-1-phenylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-N,N-bis(2-diphenylphosphanylethyl)-1-phenylethanamine?
The IUPAC name of (1S)-N,N-bis(2-diphenylphosphanylethyl)-1-phenylethanamine (CID 12743567) is (1S)-N,N-bis(2-diphenylphosphanylethyl)-1-phenylethanamine.
What is the SMILES notation for (1S)-N,N-bis(2-diphenylphosphanylethyl)-1-phenylethanamine?
The canonical SMILES for (1S)-N,N-bis(2-diphenylphosphanylethyl)-1-phenylethanamine is C[C@@H](c1ccccc1)N(CCP(c1ccccc1)c1ccccc1)CCP(c1ccccc1)c1ccccc1.
What is the InChIKey of (1S)-N,N-bis(2-diphenylphosphanylethyl)-1-phenylethanamine?
The InChIKey is ZVNAHLJBPYKGBV-HKBQPEDESA-N. The full InChI is InChI=1S/C36H37NP2/c1-31(32-17-7-2-8-18-32)37(27-29-38(33-19-9-3-10-20-33)34-21-11-4-12-22-34)28-30-39(35-23-13-5-14-24-35)36-25-15-6-16-26-36/h2-26,31H,27-30H2,1H3/t31-/m0/s1.
What are the key properties of (1S)-N,N-bis(2-diphenylphosphanylethyl)-1-phenylethanamine?
(1S)-N,N-bis(2-diphenylphosphanylethyl)-1-phenylethanamine has a molecular weight of 545.65 g/mol, XLogP of 7.32, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-N,N-bis(2-diphenylphosphanylethyl)-1-phenylethanamine is sourced from PubChem (CID 12743567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).