About 1,2,5-trimethylpyrazol-3-one;hydrate
1,2,5-trimethylpyrazol-3-one;hydrate (PubChem CID 12743652) has the molecular formula C6H12N2O2
and a molecular weight of 144.17 g/mol. Its IUPAC name is 1,2,5-trimethylpyrazol-3-one;hydrate.
Molecular Properties
| Compound Name | 1,2,5-trimethylpyrazol-3-one;hydrate |
| PubChem CID | 12743652 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | 1,2,5-trimethylpyrazol-3-one;hydrate |
| SMILES | Cc1cc(=O)n(C)n1C.O |
| InChI | InChI=1S/C6H10N2O.H2O/c1-5-4-6(9)8(3)7(5)2;/h4H,1-3H3;1H2 |
| InChIKey | RBIMMNXWZBYIOB-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 58.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,2,5-trimethylpyrazol-3-one;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,5-trimethylpyrazol-3-one;hydrate?
The IUPAC name of 1,2,5-trimethylpyrazol-3-one;hydrate (CID 12743652) is 1,2,5-trimethylpyrazol-3-one;hydrate.
What is the SMILES notation for 1,2,5-trimethylpyrazol-3-one;hydrate?
The canonical SMILES for 1,2,5-trimethylpyrazol-3-one;hydrate is Cc1cc(=O)n(C)n1C.O.
What is the InChIKey of 1,2,5-trimethylpyrazol-3-one;hydrate?
The InChIKey is RBIMMNXWZBYIOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O.H2O/c1-5-4-6(9)8(3)7(5)2;/h4H,1-3H3;1H2.
What are the key properties of 1,2,5-trimethylpyrazol-3-one;hydrate?
1,2,5-trimethylpyrazol-3-one;hydrate has a molecular weight of 144.17 g/mol, XLogP of -0.79, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,5-trimethylpyrazol-3-one;hydrate is sourced from PubChem (CID 12743652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).