C10H6F9NO — CID 12743659
1-[3,3-bis(trifluoromethyl)-2-azabicyclo[2.2.1]hept-5-en-2-yl]-2,2,2-trifluoroethanone (PubChem CID 12743659) has the molecular formula C10H6F9NO and a molecular weight of 327.15 g/mol. Its IUPAC name is 1-[3,3-bis(trifluoromethyl)-2-azabicyclo[2.2.1]hept-5-en-2-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[3,3-bis(trifluoromethyl)-2-azabicyclo[2.2.1]hept-5-en-2-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 12743659 |
| Molecular Formula | C10H6F9NO |
| Molecular Weight | 327.15 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 1-[3,3-bis(trifluoromethyl)-2-azabicyclo[2.2.1]hept-5-en-2-yl]-2,2,2-trifluoroethanone |
| SMILES | O=C(N1C2C=CC(C2)C1(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H6F9NO/c11-8(12,13)6(21)20-5-2-1-4(3-5)7(20,9(14,15)16)10(17,18)19/h1-2,4-5H,3H2 |
| InChIKey | XVKHFUWFYKPUHD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.15 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|