About ethyl 2-hydroxyheptanoate
ethyl 2-hydroxyheptanoate (PubChem CID 12743783) has the molecular formula C9H18O3
and a molecular weight of 174.24 g/mol. Its IUPAC name is ethyl 2-hydroxyheptanoate.
Molecular Properties
| Compound Name | ethyl 2-hydroxyheptanoate |
| PubChem CID | 12743783 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | ethyl 2-hydroxyheptanoate |
| SMILES | CCCCCC(O)C(=O)OCC |
| InChI | InChI=1S/C9H18O3/c1-3-5-6-7-8(10)9(11)12-4-2/h8,10H,3-7H2,1-2H3 |
| InChIKey | OCNVZDKHNZUBQB-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-hydroxyheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-hydroxyheptanoate?
The IUPAC name of ethyl 2-hydroxyheptanoate (CID 12743783) is ethyl 2-hydroxyheptanoate.
What is the SMILES notation for ethyl 2-hydroxyheptanoate?
The canonical SMILES for ethyl 2-hydroxyheptanoate is CCCCCC(O)C(=O)OCC.
What is the InChIKey of ethyl 2-hydroxyheptanoate?
The InChIKey is OCNVZDKHNZUBQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O3/c1-3-5-6-7-8(10)9(11)12-4-2/h8,10H,3-7H2,1-2H3.
What are the key properties of ethyl 2-hydroxyheptanoate?
ethyl 2-hydroxyheptanoate has a molecular weight of 174.24 g/mol, XLogP of 1.49, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-hydroxyheptanoate is sourced from PubChem (CID 12743783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).