C20H14F4O — CID 12744019
1-(3,4,5,6-tetrafluoro-15-prop-1-en-2-yl-15-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl)ethanone (PubChem CID 12744019) has the molecular formula C20H14F4O and a molecular weight of 346.32 g/mol. Its IUPAC name is 1-(3,4,5,6-tetrafluoro-15-prop-1-en-2-yl-15-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl)ethanone.
| Compound Name | 1-(3,4,5,6-tetrafluoro-15-prop-1-en-2-yl-15-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl)ethanone |
|---|---|
| PubChem CID | 12744019 |
| Molecular Formula | C20H14F4O |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 1-(3,4,5,6-tetrafluoro-15-prop-1-en-2-yl-15-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl)ethanone |
| SMILES | C=C(C)C1(C(C)=O)C2c3ccccc3C1c1c(F)c(F)c(F)c(F)c12 |
| InChI | InChI=1S/C20H14F4O/c1-8(2)20(9(3)25)14-10-6-4-5-7-11(10)15(20)13-12(14)16(21)18(23)19(24)17(13)22/h4-7,14-15H,1H2,2-3H3 |
| InChIKey | XNBVBCXWXMOINW-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|