About naphtho[3,2-e][1]benzothiole-6,11-dione
naphtho[3,2-e][1]benzothiole-6,11-dione (PubChem CID 12744370) has the molecular formula C16H8O2S
and a molecular weight of 264.31 g/mol. Its IUPAC name is naphtho[3,2-e][1]benzothiole-6,11-dione.
Molecular Properties
| Compound Name | naphtho[3,2-e][1]benzothiole-6,11-dione |
| PubChem CID | 12744370 |
| Molecular Formula | C16H8O2S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | naphtho[3,2-e][1]benzothiole-6,11-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1ccc1sccc21 |
| InChI | InChI=1S/C16H8O2S/c17-15-9-3-1-2-4-10(9)16(18)14-11-7-8-19-13(11)6-5-12(14)15/h1-8H |
| InChIKey | WTKWXGRVAFJBEY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze naphtho[3,2-e][1]benzothiole-6,11-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphtho[3,2-e][1]benzothiole-6,11-dione?
The IUPAC name of naphtho[3,2-e][1]benzothiole-6,11-dione (CID 12744370) is naphtho[3,2-e][1]benzothiole-6,11-dione.
What is the SMILES notation for naphtho[3,2-e][1]benzothiole-6,11-dione?
The canonical SMILES for naphtho[3,2-e][1]benzothiole-6,11-dione is O=C1c2ccccc2C(=O)c2c1ccc1sccc21.
What is the InChIKey of naphtho[3,2-e][1]benzothiole-6,11-dione?
The InChIKey is WTKWXGRVAFJBEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H8O2S/c17-15-9-3-1-2-4-10(9)16(18)14-11-7-8-19-13(11)6-5-12(14)15/h1-8H.
What are the key properties of naphtho[3,2-e][1]benzothiole-6,11-dione?
naphtho[3,2-e][1]benzothiole-6,11-dione has a molecular weight of 264.31 g/mol, XLogP of 3.68, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for naphtho[3,2-e][1]benzothiole-6,11-dione is sourced from PubChem (CID 12744370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).