About 4-acetylpiperazin-2-one
4-acetylpiperazin-2-one (PubChem CID 12744517) has the molecular formula C6H10N2O2
and a molecular weight of 142.16 g/mol. Its IUPAC name is 4-acetylpiperazin-2-one.
Molecular Properties
| Compound Name | 4-acetylpiperazin-2-one |
| PubChem CID | 12744517 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | 4-acetylpiperazin-2-one |
| SMILES | CC(=O)N1CCNC(=O)C1 |
| InChI | InChI=1S/C6H10N2O2/c1-5(9)8-3-2-7-6(10)4-8/h2-4H2,1H3,(H,7,10) |
| InChIKey | ISNPMTVERREURB-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-acetylpiperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetylpiperazin-2-one?
The IUPAC name of 4-acetylpiperazin-2-one (CID 12744517) is 4-acetylpiperazin-2-one.
What is the SMILES notation for 4-acetylpiperazin-2-one?
The canonical SMILES for 4-acetylpiperazin-2-one is CC(=O)N1CCNC(=O)C1.
What is the InChIKey of 4-acetylpiperazin-2-one?
The InChIKey is ISNPMTVERREURB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O2/c1-5(9)8-3-2-7-6(10)4-8/h2-4H2,1H3,(H,7,10).
What are the key properties of 4-acetylpiperazin-2-one?
4-acetylpiperazin-2-one has a molecular weight of 142.16 g/mol, XLogP of -1.04, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetylpiperazin-2-one is sourced from PubChem (CID 12744517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).