About 4-imino-2-pentan-3-ylpyrido[1,2-a]pyrimidin-9-amine
4-imino-2-pentan-3-ylpyrido[1,2-a]pyrimidin-9-amine (PubChem CID 12744577) has the molecular formula C13H18N4
and a molecular weight of 230.31 g/mol. Its IUPAC name is 4-imino-2-pentan-3-ylpyrido[1,2-a]pyrimidin-9-amine.
Molecular Properties
| Compound Name | 4-imino-2-pentan-3-ylpyrido[1,2-a]pyrimidin-9-amine |
| PubChem CID | 12744577 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 4-imino-2-pentan-3-ylpyrido[1,2-a]pyrimidin-9-amine |
| SMILES | [H]/N=c1\cc(C(CC)CC)nc2c(N)cccn12 |
| InChI | InChI=1S/C13H18N4/c1-3-9(4-2)11-8-12(15)17-7-5-6-10(14)13(17)16-11/h5-9,15H,3-4,14H2,1-2H3/b15-12+ |
| InChIKey | PCUUXJWNDWGBMT-NTCAYCPXSA-N |
| XLogP | 2.30 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-imino-2-pentan-3-ylpyrido[1,2-a]pyrimidin-9-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-imino-2-pentan-3-ylpyrido[1,2-a]pyrimidin-9-amine?
The IUPAC name of 4-imino-2-pentan-3-ylpyrido[1,2-a]pyrimidin-9-amine (CID 12744577) is 4-imino-2-pentan-3-ylpyrido[1,2-a]pyrimidin-9-amine.
What is the SMILES notation for 4-imino-2-pentan-3-ylpyrido[1,2-a]pyrimidin-9-amine?
The canonical SMILES for 4-imino-2-pentan-3-ylpyrido[1,2-a]pyrimidin-9-amine is [H]/N=c1\cc(C(CC)CC)nc2c(N)cccn12.
What is the InChIKey of 4-imino-2-pentan-3-ylpyrido[1,2-a]pyrimidin-9-amine?
The InChIKey is PCUUXJWNDWGBMT-NTCAYCPXSA-N. The full InChI is InChI=1S/C13H18N4/c1-3-9(4-2)11-8-12(15)17-7-5-6-10(14)13(17)16-11/h5-9,15H,3-4,14H2,1-2H3/b15-12+.
What are the key properties of 4-imino-2-pentan-3-ylpyrido[1,2-a]pyrimidin-9-amine?
4-imino-2-pentan-3-ylpyrido[1,2-a]pyrimidin-9-amine has a molecular weight of 230.31 g/mol, XLogP of 2.30, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-imino-2-pentan-3-ylpyrido[1,2-a]pyrimidin-9-amine is sourced from PubChem (CID 12744577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).