About (E)-1,3-dipyrrolidin-1-ylprop-2-en-1-one
(E)-1,3-dipyrrolidin-1-ylprop-2-en-1-one (PubChem CID 12744626) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is (E)-1,3-dipyrrolidin-1-ylprop-2-en-1-one.
Molecular Properties
| Compound Name | (E)-1,3-dipyrrolidin-1-ylprop-2-en-1-one |
| PubChem CID | 12744626 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | (E)-1,3-dipyrrolidin-1-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/N1CCCC1)N1CCCC1 |
| InChI | InChI=1S/C11H18N2O/c14-11(13-8-3-4-9-13)5-10-12-6-1-2-7-12/h5,10H,1-4,6-9H2/b10-5+ |
| InChIKey | MVUGNZDGVYUAID-BJMVGYQFSA-N |
| XLogP | 1.22 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1,3-dipyrrolidin-1-ylprop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,3-dipyrrolidin-1-ylprop-2-en-1-one?
The IUPAC name of (E)-1,3-dipyrrolidin-1-ylprop-2-en-1-one (CID 12744626) is (E)-1,3-dipyrrolidin-1-ylprop-2-en-1-one.
What is the SMILES notation for (E)-1,3-dipyrrolidin-1-ylprop-2-en-1-one?
The canonical SMILES for (E)-1,3-dipyrrolidin-1-ylprop-2-en-1-one is O=C(/C=C/N1CCCC1)N1CCCC1.
What is the InChIKey of (E)-1,3-dipyrrolidin-1-ylprop-2-en-1-one?
The InChIKey is MVUGNZDGVYUAID-BJMVGYQFSA-N. The full InChI is InChI=1S/C11H18N2O/c14-11(13-8-3-4-9-13)5-10-12-6-1-2-7-12/h5,10H,1-4,6-9H2/b10-5+.
What are the key properties of (E)-1,3-dipyrrolidin-1-ylprop-2-en-1-one?
(E)-1,3-dipyrrolidin-1-ylprop-2-en-1-one has a molecular weight of 194.28 g/mol, XLogP of 1.22, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,3-dipyrrolidin-1-ylprop-2-en-1-one is sourced from PubChem (CID 12744626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).