C15H28N4O3 — CID 12745406
1-[3-(3-aminopropylamino)propyl]-5,5-diethyl-3-methyl-1,3-diazinane-2,4,6-trione (PubChem CID 12745406) has the molecular formula C15H28N4O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is 1-[3-(3-aminopropylamino)propyl]-5,5-diethyl-3-methyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-[3-(3-aminopropylamino)propyl]-5,5-diethyl-3-methyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 12745406 |
| Molecular Formula | C15H28N4O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | 1-[3-(3-aminopropylamino)propyl]-5,5-diethyl-3-methyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCC1(CC)C(=O)N(C)C(=O)N(CCCNCCCN)C1=O |
| InChI | InChI=1S/C15H28N4O3/c1-4-15(5-2)12(20)18(3)14(22)19(13(15)21)11-7-10-17-9-6-8-16/h17H,4-11,16H2,1-3H3 |
| InChIKey | KVCNJFOHWFLYAT-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|