C16H13BrN2O4 — CID 1274624
5-[[(2-bromobenzoyl)hydrazinylidene]methyl]-2-methoxybenzoic acid (PubChem CID 1274624) has the molecular formula C16H13BrN2O4 and a molecular weight of 377.19 g/mol. Its IUPAC name is 5-[[(2-bromobenzoyl)hydrazinylidene]methyl]-2-methoxybenzoic acid.
| Compound Name | 5-[[(2-bromobenzoyl)hydrazinylidene]methyl]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 1274624 |
| Molecular Formula | C16H13BrN2O4 |
| Molecular Weight | 377.19 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | 5-[[(2-bromobenzoyl)hydrazinylidene]methyl]-2-methoxybenzoic acid |
| SMILES | COc1ccc(C=NNC(=O)c2ccccc2Br)cc1C(=O)O |
| InChI | InChI=1S/C16H13BrN2O4/c1-23-14-7-6-10(8-12(14)16(21)22)9-18-19-15(20)11-4-2-3-5-13(11)17/h2-9H,1H3,(H,19,20)(H,21,22) |
| InChIKey | FHUMCILULQNLJP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.19 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|