C21H24N4O2S — CID 127470187
6-[2-(methoxymethyl)-5-phenylthieno[2,3-d]pyrimidin-4-yl]-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine (PubChem CID 127470187) has the molecular formula C21H24N4O2S and a molecular weight of 396.52 g/mol. Its IUPAC name is 6-[2-(methoxymethyl)-5-phenylthieno[2,3-d]pyrimidin-4-yl]-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine.
| Compound Name | 6-[2-(methoxymethyl)-5-phenylthieno[2,3-d]pyrimidin-4-yl]-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 127470187 |
| Molecular Formula | C21H24N4O2S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 6-[2-(methoxymethyl)-5-phenylthieno[2,3-d]pyrimidin-4-yl]-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
| SMILES | COCc1nc(N2CC3OCCN(C)C3C2)c2c(-c3ccccc3)csc2n1 |
| InChI | InChI=1S/C21H24N4O2S/c1-24-8-9-27-17-11-25(10-16(17)24)20-19-15(14-6-4-3-5-7-14)13-28-21(19)23-18(22-20)12-26-2/h3-7,13,16-17H,8-12H2,1-2H3 |
| InChIKey | UUUMBAUOPMBIQB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |