About 2,2-diphenyl-1-(1,3-thiazol-2-yl)ethanone
2,2-diphenyl-1-(1,3-thiazol-2-yl)ethanone (PubChem CID 12747837) has the molecular formula C17H13NOS
and a molecular weight of 279.36 g/mol. Its IUPAC name is 2,2-diphenyl-1-(1,3-thiazol-2-yl)ethanone.
Molecular Properties
| Compound Name | 2,2-diphenyl-1-(1,3-thiazol-2-yl)ethanone |
| PubChem CID | 12747837 |
| Molecular Formula | C17H13NOS |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 2,2-diphenyl-1-(1,3-thiazol-2-yl)ethanone |
| SMILES | O=C(c1nccs1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H13NOS/c19-16(17-18-11-12-20-17)15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-12,15H |
| InChIKey | FRLLVXNEUIPCTO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-diphenyl-1-(1,3-thiazol-2-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diphenyl-1-(1,3-thiazol-2-yl)ethanone?
The IUPAC name of 2,2-diphenyl-1-(1,3-thiazol-2-yl)ethanone (CID 12747837) is 2,2-diphenyl-1-(1,3-thiazol-2-yl)ethanone.
What is the SMILES notation for 2,2-diphenyl-1-(1,3-thiazol-2-yl)ethanone?
The canonical SMILES for 2,2-diphenyl-1-(1,3-thiazol-2-yl)ethanone is O=C(c1nccs1)C(c1ccccc1)c1ccccc1.
What is the InChIKey of 2,2-diphenyl-1-(1,3-thiazol-2-yl)ethanone?
The InChIKey is FRLLVXNEUIPCTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13NOS/c19-16(17-18-11-12-20-17)15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-12,15H.
What are the key properties of 2,2-diphenyl-1-(1,3-thiazol-2-yl)ethanone?
2,2-diphenyl-1-(1,3-thiazol-2-yl)ethanone has a molecular weight of 279.36 g/mol, XLogP of 4.16, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diphenyl-1-(1,3-thiazol-2-yl)ethanone is sourced from PubChem (CID 12747837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).