C13H15N3O2 — CID 12748079
8,9-dimethoxy-5,6-dihydroimidazo[5,1-a]isoquinolin-3-amine (PubChem CID 12748079) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 8,9-dimethoxy-5,6-dihydroimidazo[5,1-a]isoquinolin-3-amine.
| Compound Name | 8,9-dimethoxy-5,6-dihydroimidazo[5,1-a]isoquinolin-3-amine |
|---|---|
| PubChem CID | 12748079 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 8,9-dimethoxy-5,6-dihydroimidazo[5,1-a]isoquinolin-3-amine |
| SMILES | COc1cc2c(cc1OC)-c1cnc(N)n1CC2 |
| InChI | InChI=1S/C13H15N3O2/c1-17-11-5-8-3-4-16-10(7-15-13(16)14)9(8)6-12(11)18-2/h5-7H,3-4H2,1-2H3,(H2,14,15) |
| InChIKey | OMACPDYTRBSGOS-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |