About (5E)-5-(iodomethylidene)-2-phenyl-4H-1,3-oxazole
(5E)-5-(iodomethylidene)-2-phenyl-4H-1,3-oxazole (PubChem CID 12748354) has the molecular formula C10H8INO
and a molecular weight of 285.08 g/mol. Its IUPAC name is (5E)-5-(iodomethylidene)-2-phenyl-4H-1,3-oxazole.
Molecular Properties
| Compound Name | (5E)-5-(iodomethylidene)-2-phenyl-4H-1,3-oxazole |
| PubChem CID | 12748354 |
| Molecular Formula | C10H8INO |
| Molecular Weight | 285.08 g/mol |
| Exact Mass | 284.97 |
| IUPAC Name | (5E)-5-(iodomethylidene)-2-phenyl-4H-1,3-oxazole |
| SMILES | I/C=C1\CN=C(c2ccccc2)O1 |
| InChI | InChI=1S/C10H8INO/c11-6-9-7-12-10(13-9)8-4-2-1-3-5-8/h1-6H,7H2/b9-6+ |
| InChIKey | MFVVFMYJNYWQBC-RMKNXTFCSA-N |
| XLogP | 2.74 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.08 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (5E)-5-(iodomethylidene)-2-phenyl-4H-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-5-(iodomethylidene)-2-phenyl-4H-1,3-oxazole?
The IUPAC name of (5E)-5-(iodomethylidene)-2-phenyl-4H-1,3-oxazole (CID 12748354) is (5E)-5-(iodomethylidene)-2-phenyl-4H-1,3-oxazole.
What is the SMILES notation for (5E)-5-(iodomethylidene)-2-phenyl-4H-1,3-oxazole?
The canonical SMILES for (5E)-5-(iodomethylidene)-2-phenyl-4H-1,3-oxazole is I/C=C1\CN=C(c2ccccc2)O1.
What is the InChIKey of (5E)-5-(iodomethylidene)-2-phenyl-4H-1,3-oxazole?
The InChIKey is MFVVFMYJNYWQBC-RMKNXTFCSA-N. The full InChI is InChI=1S/C10H8INO/c11-6-9-7-12-10(13-9)8-4-2-1-3-5-8/h1-6H,7H2/b9-6+.
What are the key properties of (5E)-5-(iodomethylidene)-2-phenyl-4H-1,3-oxazole?
(5E)-5-(iodomethylidene)-2-phenyl-4H-1,3-oxazole has a molecular weight of 285.08 g/mol, XLogP of 2.74, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-5-(iodomethylidene)-2-phenyl-4H-1,3-oxazole is sourced from PubChem (CID 12748354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).