3-ethylpent-2-enoic acid

C7H12O2 — CID 12748359

IUPAC3-ethylpent-2-enoic acid
SMILESCCC(=CC(=O)O)CC
InChIInChI=1S/C7H12O2/c1-3-6(4-2)5-7(8)9/h5H,3-4H2,1-2H3,(H,8,9)
InChIKeyLKHHEMHSIKGIBO-UHFFFAOYSA-N
MW128.17 g/mol
LogP1.82
Rot. Bonds3

About 3-ethylpent-2-enoic acid

3-ethylpent-2-enoic acid (PubChem CID 12748359) has the molecular formula C7H12O2 and a molecular weight of 128.17 g/mol. Its IUPAC name is 3-ethylpent-2-enoic acid.

Molecular Properties

Compound Name3-ethylpent-2-enoic acid
PubChem CID12748359
Molecular FormulaC7H12O2
Molecular Weight128.17 g/mol
Exact Mass128.08
IUPAC Name3-ethylpent-2-enoic acid
SMILESCCC(=CC(=O)O)CC
InChIInChI=1S/C7H12O2/c1-3-6(4-2)5-7(8)9/h5H,3-4H2,1-2H3,(H,8,9)
InChIKeyLKHHEMHSIKGIBO-UHFFFAOYSA-N
XLogP1.82
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500128.17
LogP ≤ 51.82
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 3-ethylpent-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-ethylpent-2-enoic acid?
The IUPAC name of 3-ethylpent-2-enoic acid (CID 12748359) is 3-ethylpent-2-enoic acid.
What is the SMILES notation for 3-ethylpent-2-enoic acid?
The canonical SMILES for 3-ethylpent-2-enoic acid is CCC(=CC(=O)O)CC.
What is the InChIKey of 3-ethylpent-2-enoic acid?
The InChIKey is LKHHEMHSIKGIBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2/c1-3-6(4-2)5-7(8)9/h5H,3-4H2,1-2H3,(H,8,9).
What are the key properties of 3-ethylpent-2-enoic acid?
3-ethylpent-2-enoic acid has a molecular weight of 128.17 g/mol, XLogP of 1.82, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylpent-2-enoic acid is sourced from PubChem (CID 12748359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).