About (E)-3-(4,6-dimethylpyrimidin-2-yl)prop-2-enenitrile
(E)-3-(4,6-dimethylpyrimidin-2-yl)prop-2-enenitrile (PubChem CID 12749078) has the molecular formula C9H9N3
and a molecular weight of 159.19 g/mol. Its IUPAC name is (E)-3-(4,6-dimethylpyrimidin-2-yl)prop-2-enenitrile.
Molecular Properties
| Compound Name | (E)-3-(4,6-dimethylpyrimidin-2-yl)prop-2-enenitrile |
| PubChem CID | 12749078 |
| Molecular Formula | C9H9N3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | (E)-3-(4,6-dimethylpyrimidin-2-yl)prop-2-enenitrile |
| SMILES | Cc1cc(C)nc(/C=C/C#N)n1 |
| InChI | InChI=1S/C9H9N3/c1-7-6-8(2)12-9(11-7)4-3-5-10/h3-4,6H,1-2H3/b4-3+ |
| InChIKey | FTKNEUKKXMEEHY-ONEGZZNKSA-N |
| XLogP | 1.63 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(4,6-dimethylpyrimidin-2-yl)prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(4,6-dimethylpyrimidin-2-yl)prop-2-enenitrile?
The IUPAC name of (E)-3-(4,6-dimethylpyrimidin-2-yl)prop-2-enenitrile (CID 12749078) is (E)-3-(4,6-dimethylpyrimidin-2-yl)prop-2-enenitrile.
What is the SMILES notation for (E)-3-(4,6-dimethylpyrimidin-2-yl)prop-2-enenitrile?
The canonical SMILES for (E)-3-(4,6-dimethylpyrimidin-2-yl)prop-2-enenitrile is Cc1cc(C)nc(/C=C/C#N)n1.
What is the InChIKey of (E)-3-(4,6-dimethylpyrimidin-2-yl)prop-2-enenitrile?
The InChIKey is FTKNEUKKXMEEHY-ONEGZZNKSA-N. The full InChI is InChI=1S/C9H9N3/c1-7-6-8(2)12-9(11-7)4-3-5-10/h3-4,6H,1-2H3/b4-3+.
What are the key properties of (E)-3-(4,6-dimethylpyrimidin-2-yl)prop-2-enenitrile?
(E)-3-(4,6-dimethylpyrimidin-2-yl)prop-2-enenitrile has a molecular weight of 159.19 g/mol, XLogP of 1.63, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(4,6-dimethylpyrimidin-2-yl)prop-2-enenitrile is sourced from PubChem (CID 12749078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).