C19H18N2O2 — CID 1274909
N'-[(5R)-3-oxo-5-phenylcyclohexen-1-yl]benzohydrazide (PubChem CID 1274909) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is N'-[(5R)-3-oxo-5-phenylcyclohexen-1-yl]benzohydrazide.
| Compound Name | N'-[(5R)-3-oxo-5-phenylcyclohexen-1-yl]benzohydrazide |
|---|---|
| PubChem CID | 1274909 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | N'-[(5R)-3-oxo-5-phenylcyclohexen-1-yl]benzohydrazide |
| SMILES | O=C1C=C(NNC(=O)c2ccccc2)C[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C19H18N2O2/c22-18-12-16(14-7-3-1-4-8-14)11-17(13-18)20-21-19(23)15-9-5-2-6-10-15/h1-10,13,16,20H,11-12H2,(H,21,23)/t16-/m1/s1 |
| InChIKey | IGUWGOACNHQENL-MRXNPFEDSA-N |
| XLogP | 2.95 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|