C26H24N2O3 — CID 1275000
(E)-2-cyano-N-[[(2S)-oxolan-2-yl]methyl]-3-(2-phenylmethoxynaphthalen-1-yl)prop-2-enamide (PubChem CID 1275000) has the molecular formula C26H24N2O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is (E)-2-cyano-N-[[(2S)-oxolan-2-yl]methyl]-3-(2-phenylmethoxynaphthalen-1-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-[[(2S)-oxolan-2-yl]methyl]-3-(2-phenylmethoxynaphthalen-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 1275000 |
| Molecular Formula | C26H24N2O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | (E)-2-cyano-N-[[(2S)-oxolan-2-yl]methyl]-3-(2-phenylmethoxynaphthalen-1-yl)prop-2-enamide |
| SMILES | N#C/C(=C\c1c(OCc2ccccc2)ccc2ccccc12)C(=O)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C26H24N2O3/c27-16-21(26(29)28-17-22-10-6-14-30-22)15-24-23-11-5-4-9-20(23)12-13-25(24)31-18-19-7-2-1-3-8-19/h1-5,7-9,11-13,15,22H,6,10,14,17-18H2,(H,28,29)/b21-15+/t22-/m0/s1 |
| InChIKey | KEYVISVOOWQCHN-VAZXNAHHSA-N |
| XLogP | 4.62 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|