About 3,4,5,6-tetramethylpyridazine
3,4,5,6-tetramethylpyridazine (PubChem CID 12750033) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is 3,4,5,6-tetramethylpyridazine.
Molecular Properties
| Compound Name | 3,4,5,6-tetramethylpyridazine |
| PubChem CID | 12750033 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 3,4,5,6-tetramethylpyridazine |
| SMILES | Cc1nnc(C)c(C)c1C |
| InChI | InChI=1S/C8H12N2/c1-5-6(2)8(4)10-9-7(5)3/h1-4H3 |
| InChIKey | GHAPXTSQLKUQLE-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4,5,6-tetramethylpyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,5,6-tetramethylpyridazine?
The IUPAC name of 3,4,5,6-tetramethylpyridazine (CID 12750033) is 3,4,5,6-tetramethylpyridazine.
What is the SMILES notation for 3,4,5,6-tetramethylpyridazine?
The canonical SMILES for 3,4,5,6-tetramethylpyridazine is Cc1nnc(C)c(C)c1C.
What is the InChIKey of 3,4,5,6-tetramethylpyridazine?
The InChIKey is GHAPXTSQLKUQLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2/c1-5-6(2)8(4)10-9-7(5)3/h1-4H3.
What are the key properties of 3,4,5,6-tetramethylpyridazine?
3,4,5,6-tetramethylpyridazine has a molecular weight of 136.20 g/mol, XLogP of 1.71, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,5,6-tetramethylpyridazine is sourced from PubChem (CID 12750033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).