C16H20O2 — CID 12750258
[(4bR,8aR)-4b-(hydroxymethyl)-5,8,9,10-tetrahydrophenanthren-8a-yl]methanol (PubChem CID 12750258) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is [(4bR,8aR)-4b-(hydroxymethyl)-5,8,9,10-tetrahydrophenanthren-8a-yl]methanol.
| Compound Name | [(4bR,8aR)-4b-(hydroxymethyl)-5,8,9,10-tetrahydrophenanthren-8a-yl]methanol |
|---|---|
| PubChem CID | 12750258 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | [(4bR,8aR)-4b-(hydroxymethyl)-5,8,9,10-tetrahydrophenanthren-8a-yl]methanol |
| SMILES | OC[C@]12CC=CC[C@@]1(CO)c1ccccc1CC2 |
| InChI | InChI=1S/C16H20O2/c17-11-15-8-3-4-9-16(15,12-18)14-6-2-1-5-13(14)7-10-15/h1-6,17-18H,7-12H2/t15-,16-/m1/s1 |
| InChIKey | CYHXCIAJIUKFLX-HZPDHXFCSA-N |
| XLogP | 2.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|