About ethyl-methyl-phenyl-trimethylsilylimino-lambda5-phosphane
ethyl-methyl-phenyl-trimethylsilylimino-lambda5-phosphane (PubChem CID 12750881) has the molecular formula C12H22NPSi
and a molecular weight of 239.38 g/mol. Its IUPAC name is ethyl-methyl-phenyl-trimethylsilylimino-lambda5-phosphane.
Molecular Properties
| Compound Name | ethyl-methyl-phenyl-trimethylsilylimino-lambda5-phosphane |
| PubChem CID | 12750881 |
| Molecular Formula | C12H22NPSi |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | ethyl-methyl-phenyl-trimethylsilylimino-lambda5-phosphane |
| SMILES | CCP(C)(=N[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C12H22NPSi/c1-6-14(2,13-15(3,4)5)12-10-8-7-9-11-12/h7-11H,6H2,1-5H3 |
| InChIKey | FHJZXSUXMJHWQT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethyl-methyl-phenyl-trimethylsilylimino-lambda5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl-methyl-phenyl-trimethylsilylimino-lambda5-phosphane?
The IUPAC name of ethyl-methyl-phenyl-trimethylsilylimino-lambda5-phosphane (CID 12750881) is ethyl-methyl-phenyl-trimethylsilylimino-lambda5-phosphane.
What is the SMILES notation for ethyl-methyl-phenyl-trimethylsilylimino-lambda5-phosphane?
The canonical SMILES for ethyl-methyl-phenyl-trimethylsilylimino-lambda5-phosphane is CCP(C)(=N[Si](C)(C)C)c1ccccc1.
What is the InChIKey of ethyl-methyl-phenyl-trimethylsilylimino-lambda5-phosphane?
The InChIKey is FHJZXSUXMJHWQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22NPSi/c1-6-14(2,13-15(3,4)5)12-10-8-7-9-11-12/h7-11H,6H2,1-5H3.
What are the key properties of ethyl-methyl-phenyl-trimethylsilylimino-lambda5-phosphane?
ethyl-methyl-phenyl-trimethylsilylimino-lambda5-phosphane has a molecular weight of 239.38 g/mol, XLogP of 4.00, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl-methyl-phenyl-trimethylsilylimino-lambda5-phosphane is sourced from PubChem (CID 12750881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).