About N,N-diethylcarbamoyl fluoride
N,N-diethylcarbamoyl fluoride (PubChem CID 12750942) has the molecular formula C5H10FNO
and a molecular weight of 119.14 g/mol. Its IUPAC name is N,N-diethylcarbamoyl fluoride.
Molecular Properties
| Compound Name | N,N-diethylcarbamoyl fluoride |
| PubChem CID | 12750942 |
| Molecular Formula | C5H10FNO |
| Molecular Weight | 119.14 g/mol |
| Exact Mass | 119.07 |
| IUPAC Name | N,N-diethylcarbamoyl fluoride |
| SMILES | CCN(CC)C(=O)F |
| InChI | InChI=1S/C5H10FNO/c1-3-7(4-2)5(6)8/h3-4H2,1-2H3 |
| InChIKey | VHDCQXZUGLTOHS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.14 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethylcarbamoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylcarbamoyl fluoride?
The IUPAC name of N,N-diethylcarbamoyl fluoride (CID 12750942) is N,N-diethylcarbamoyl fluoride.
What is the SMILES notation for N,N-diethylcarbamoyl fluoride?
The canonical SMILES for N,N-diethylcarbamoyl fluoride is CCN(CC)C(=O)F.
What is the InChIKey of N,N-diethylcarbamoyl fluoride?
The InChIKey is VHDCQXZUGLTOHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10FNO/c1-3-7(4-2)5(6)8/h3-4H2,1-2H3.
What are the key properties of N,N-diethylcarbamoyl fluoride?
N,N-diethylcarbamoyl fluoride has a molecular weight of 119.14 g/mol, XLogP of 1.42, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylcarbamoyl fluoride is sourced from PubChem (CID 12750942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).