C8H2F14 — CID 12751148
(E)-1,1,1,2,2,3,3,6,6,7,7,8,8,8-tetradecafluorooct-4-ene (PubChem CID 12751148) has the molecular formula C8H2F14 and a molecular weight of 364.08 g/mol. Its IUPAC name is (E)-1,1,1,2,2,3,3,6,6,7,7,8,8,8-tetradecafluorooct-4-ene.
| Compound Name | (E)-1,1,1,2,2,3,3,6,6,7,7,8,8,8-tetradecafluorooct-4-ene |
|---|---|
| PubChem CID | 12751148 |
| Molecular Formula | C8H2F14 |
| Molecular Weight | 364.08 g/mol |
| Exact Mass | 363.99 |
| IUPAC Name | (E)-1,1,1,2,2,3,3,6,6,7,7,8,8,8-tetradecafluorooct-4-ene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)/C=C/C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H2F14/c9-3(10,5(13,14)7(17,18)19)1-2-4(11,12)6(15,16)8(20,21)22/h1-2H/b2-1+ |
| InChIKey | NIJFGUAYRFPTBD-OWOJBTEDSA-N |
| XLogP | 5.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.08 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|