C18H22N4 — CID 12751416
3,5-dimethyl-7-phenyl-1,3,4,8-tetrazatricyclo[8.4.0.02,6]tetradeca-2(6),4,7-triene (PubChem CID 12751416) has the molecular formula C18H22N4 and a molecular weight of 294.40 g/mol. Its IUPAC name is 3,5-dimethyl-7-phenyl-1,3,4,8-tetrazatricyclo[8.4.0.02,6]tetradeca-2(6),4,7-triene.
| Compound Name | 3,5-dimethyl-7-phenyl-1,3,4,8-tetrazatricyclo[8.4.0.02,6]tetradeca-2(6),4,7-triene |
|---|---|
| PubChem CID | 12751416 |
| Molecular Formula | C18H22N4 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 3,5-dimethyl-7-phenyl-1,3,4,8-tetrazatricyclo[8.4.0.02,6]tetradeca-2(6),4,7-triene |
| SMILES | Cc1nn(C)c2c1C(c1ccccc1)=NCC1CCCCN21 |
| InChI | InChI=1S/C18H22N4/c1-13-16-17(14-8-4-3-5-9-14)19-12-15-10-6-7-11-22(15)18(16)21(2)20-13/h3-5,8-9,15H,6-7,10-12H2,1-2H3 |
| InChIKey | GTVRBDXNWBDDGU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |