About 2-(1,3-dihydro-2-benzofuran-5-yl)ethanamine
2-(1,3-dihydro-2-benzofuran-5-yl)ethanamine (PubChem CID 12751752) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 2-(1,3-dihydro-2-benzofuran-5-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(1,3-dihydro-2-benzofuran-5-yl)ethanamine |
| PubChem CID | 12751752 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 2-(1,3-dihydro-2-benzofuran-5-yl)ethanamine |
| SMILES | NCCc1ccc2c(c1)COC2 |
| InChI | InChI=1S/C10H13NO/c11-4-3-8-1-2-9-6-12-7-10(9)5-8/h1-2,5H,3-4,6-7,11H2 |
| InChIKey | ITZAREVHWOKQBH-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1,3-dihydro-2-benzofuran-5-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dihydro-2-benzofuran-5-yl)ethanamine?
The IUPAC name of 2-(1,3-dihydro-2-benzofuran-5-yl)ethanamine (CID 12751752) is 2-(1,3-dihydro-2-benzofuran-5-yl)ethanamine.
What is the SMILES notation for 2-(1,3-dihydro-2-benzofuran-5-yl)ethanamine?
The canonical SMILES for 2-(1,3-dihydro-2-benzofuran-5-yl)ethanamine is NCCc1ccc2c(c1)COC2.
What is the InChIKey of 2-(1,3-dihydro-2-benzofuran-5-yl)ethanamine?
The InChIKey is ITZAREVHWOKQBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c11-4-3-8-1-2-9-6-12-7-10(9)5-8/h1-2,5H,3-4,6-7,11H2.
What are the key properties of 2-(1,3-dihydro-2-benzofuran-5-yl)ethanamine?
2-(1,3-dihydro-2-benzofuran-5-yl)ethanamine has a molecular weight of 163.22 g/mol, XLogP of 1.22, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dihydro-2-benzofuran-5-yl)ethanamine is sourced from PubChem (CID 12751752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).