C24H12Cl2F12N4 — CID 12753426
5,10-bis(4-chlorophenyl)-3,3,12,12-tetrakis(trifluoromethyl)-4,6,9,11-tetrazatricyclo[7.3.0.02,6]dodeca-4,7,10-triene (PubChem CID 12753426) has the molecular formula C24H12Cl2F12N4 and a molecular weight of 655.27 g/mol. Its IUPAC name is 5,10-bis(4-chlorophenyl)-3,3,12,12-tetrakis(trifluoromethyl)-4,6,9,11-tetrazatricyclo[7.3.0.02,6]dodeca-4,7,10-triene.
| Compound Name | 5,10-bis(4-chlorophenyl)-3,3,12,12-tetrakis(trifluoromethyl)-4,6,9,11-tetrazatricyclo[7.3.0.02,6]dodeca-4,7,10-triene |
|---|---|
| PubChem CID | 12753426 |
| Molecular Formula | C24H12Cl2F12N4 |
| Molecular Weight | 655.27 g/mol |
| Exact Mass | 654.02 |
| IUPAC Name | 5,10-bis(4-chlorophenyl)-3,3,12,12-tetrakis(trifluoromethyl)-4,6,9,11-tetrazatricyclo[7.3.0.02,6]dodeca-4,7,10-triene |
| SMILES | FC(F)(F)C1(C(F)(F)F)N=C(c2ccc(Cl)cc2)N2C=CN3C(c4ccc(Cl)cc4)=NC(C(F)(F)F)(C(F)(F)F)C3C21 |
| InChI | InChI=1S/C24H12Cl2F12N4/c25-13-5-1-11(2-6-13)17-39-19(21(27,28)29,22(30,31)32)15-16-20(23(33,34)35,24(36,37)38)40-18(42(16)10-9-41(15)17)12-3-7-14(26)8-4-12/h1-10,15-16H |
| InChIKey | TZOWUTFNQMUCLO-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.27 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |