About phenyl-(2,3,4,5-tetrafluoro-6-phenylphenyl)methanone
phenyl-(2,3,4,5-tetrafluoro-6-phenylphenyl)methanone (PubChem CID 12753960) has the molecular formula C19H10F4O
and a molecular weight of 330.28 g/mol. Its IUPAC name is phenyl-(2,3,4,5-tetrafluoro-6-phenylphenyl)methanone.
Molecular Properties
| Compound Name | phenyl-(2,3,4,5-tetrafluoro-6-phenylphenyl)methanone |
| PubChem CID | 12753960 |
| Molecular Formula | C19H10F4O |
| Molecular Weight | 330.28 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | phenyl-(2,3,4,5-tetrafluoro-6-phenylphenyl)methanone |
| SMILES | O=C(c1ccccc1)c1c(F)c(F)c(F)c(F)c1-c1ccccc1 |
| InChI | InChI=1S/C19H10F4O/c20-15-13(11-7-3-1-4-8-11)14(16(21)18(23)17(15)22)19(24)12-9-5-2-6-10-12/h1-10H |
| InChIKey | JIFLTMPARKVSLP-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.28 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze phenyl-(2,3,4,5-tetrafluoro-6-phenylphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl-(2,3,4,5-tetrafluoro-6-phenylphenyl)methanone?
The IUPAC name of phenyl-(2,3,4,5-tetrafluoro-6-phenylphenyl)methanone (CID 12753960) is phenyl-(2,3,4,5-tetrafluoro-6-phenylphenyl)methanone.
What is the SMILES notation for phenyl-(2,3,4,5-tetrafluoro-6-phenylphenyl)methanone?
The canonical SMILES for phenyl-(2,3,4,5-tetrafluoro-6-phenylphenyl)methanone is O=C(c1ccccc1)c1c(F)c(F)c(F)c(F)c1-c1ccccc1.
What is the InChIKey of phenyl-(2,3,4,5-tetrafluoro-6-phenylphenyl)methanone?
The InChIKey is JIFLTMPARKVSLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H10F4O/c20-15-13(11-7-3-1-4-8-11)14(16(21)18(23)17(15)22)19(24)12-9-5-2-6-10-12/h1-10H.
What are the key properties of phenyl-(2,3,4,5-tetrafluoro-6-phenylphenyl)methanone?
phenyl-(2,3,4,5-tetrafluoro-6-phenylphenyl)methanone has a molecular weight of 330.28 g/mol, XLogP of 5.14, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl-(2,3,4,5-tetrafluoro-6-phenylphenyl)methanone is sourced from PubChem (CID 12753960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).