About 2-hydroxy-4-oxatricyclo[4.3.1.13,8]undecan-5-one
2-hydroxy-4-oxatricyclo[4.3.1.13,8]undecan-5-one (PubChem CID 12754092) has the molecular formula C10H14O3
and a molecular weight of 182.22 g/mol. Its IUPAC name is 2-hydroxy-4-oxatricyclo[4.3.1.13,8]undecan-5-one.
Molecular Properties
| Compound Name | 2-hydroxy-4-oxatricyclo[4.3.1.13,8]undecan-5-one |
| PubChem CID | 12754092 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 2-hydroxy-4-oxatricyclo[4.3.1.13,8]undecan-5-one |
| SMILES | O=C1OC2CC3CC1CC(C3)C2O |
| InChI | InChI=1S/C10H14O3/c11-9-6-1-5-2-7(4-6)10(12)13-8(9)3-5/h5-9,11H,1-4H2 |
| InChIKey | DVBXJJBQWMKSMD-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxy-4-oxatricyclo[4.3.1.13,8]undecan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-4-oxatricyclo[4.3.1.13,8]undecan-5-one?
The IUPAC name of 2-hydroxy-4-oxatricyclo[4.3.1.13,8]undecan-5-one (CID 12754092) is 2-hydroxy-4-oxatricyclo[4.3.1.13,8]undecan-5-one.
What is the SMILES notation for 2-hydroxy-4-oxatricyclo[4.3.1.13,8]undecan-5-one?
The canonical SMILES for 2-hydroxy-4-oxatricyclo[4.3.1.13,8]undecan-5-one is O=C1OC2CC3CC1CC(C3)C2O.
What is the InChIKey of 2-hydroxy-4-oxatricyclo[4.3.1.13,8]undecan-5-one?
The InChIKey is DVBXJJBQWMKSMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O3/c11-9-6-1-5-2-7(4-6)10(12)13-8(9)3-5/h5-9,11H,1-4H2.
What are the key properties of 2-hydroxy-4-oxatricyclo[4.3.1.13,8]undecan-5-one?
2-hydroxy-4-oxatricyclo[4.3.1.13,8]undecan-5-one has a molecular weight of 182.22 g/mol, XLogP of 0.71, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-4-oxatricyclo[4.3.1.13,8]undecan-5-one is sourced from PubChem (CID 12754092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).