About (1-methylpiperidin-4-yl) piperazine-1-carboxylate
(1-methylpiperidin-4-yl) piperazine-1-carboxylate (PubChem CID 127541235) has the molecular formula C11H21N3O2
and a molecular weight of 227.31 g/mol. Its IUPAC name is (1-methylpiperidin-4-yl) piperazine-1-carboxylate.
Molecular Properties
| Compound Name | (1-methylpiperidin-4-yl) piperazine-1-carboxylate |
| PubChem CID | 127541235 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | (1-methylpiperidin-4-yl) piperazine-1-carboxylate |
| SMILES | CN1CCC(OC(=O)N2CCNCC2)CC1 |
| InChI | InChI=1S/C11H21N3O2/c1-13-6-2-10(3-7-13)16-11(15)14-8-4-12-5-9-14/h10,12H,2-9H2,1H3 |
| InChIKey | RNXICIZRVCLWQV-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-methylpiperidin-4-yl) piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpiperidin-4-yl) piperazine-1-carboxylate?
The IUPAC name of (1-methylpiperidin-4-yl) piperazine-1-carboxylate (CID 127541235) is (1-methylpiperidin-4-yl) piperazine-1-carboxylate.
What is the SMILES notation for (1-methylpiperidin-4-yl) piperazine-1-carboxylate?
The canonical SMILES for (1-methylpiperidin-4-yl) piperazine-1-carboxylate is CN1CCC(OC(=O)N2CCNCC2)CC1.
What is the InChIKey of (1-methylpiperidin-4-yl) piperazine-1-carboxylate?
The InChIKey is RNXICIZRVCLWQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O2/c1-13-6-2-10(3-7-13)16-11(15)14-8-4-12-5-9-14/h10,12H,2-9H2,1H3.
What are the key properties of (1-methylpiperidin-4-yl) piperazine-1-carboxylate?
(1-methylpiperidin-4-yl) piperazine-1-carboxylate has a molecular weight of 227.31 g/mol, XLogP of 0.12, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpiperidin-4-yl) piperazine-1-carboxylate is sourced from PubChem (CID 127541235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).