About 5,5-diethoxypent-1-yn-3-ol
5,5-diethoxypent-1-yn-3-ol (PubChem CID 12754307) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is 5,5-diethoxypent-1-yn-3-ol.
Molecular Properties
| Compound Name | 5,5-diethoxypent-1-yn-3-ol |
| PubChem CID | 12754307 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 5,5-diethoxypent-1-yn-3-ol |
| SMILES | C#CC(O)CC(OCC)OCC |
| InChI | InChI=1S/C9H16O3/c1-4-8(10)7-9(11-5-2)12-6-3/h1,8-10H,5-7H2,2-3H3 |
| InChIKey | SUVLKQWRAPHVAC-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5,5-diethoxypent-1-yn-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-diethoxypent-1-yn-3-ol?
The IUPAC name of 5,5-diethoxypent-1-yn-3-ol (CID 12754307) is 5,5-diethoxypent-1-yn-3-ol.
What is the SMILES notation for 5,5-diethoxypent-1-yn-3-ol?
The canonical SMILES for 5,5-diethoxypent-1-yn-3-ol is C#CC(O)CC(OCC)OCC.
What is the InChIKey of 5,5-diethoxypent-1-yn-3-ol?
The InChIKey is SUVLKQWRAPHVAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3/c1-4-8(10)7-9(11-5-2)12-6-3/h1,8-10H,5-7H2,2-3H3.
What are the key properties of 5,5-diethoxypent-1-yn-3-ol?
5,5-diethoxypent-1-yn-3-ol has a molecular weight of 172.22 g/mol, XLogP of 0.77, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-diethoxypent-1-yn-3-ol is sourced from PubChem (CID 12754307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).