About 4-methyl-2,4,6-triazatricyclo[5.1.1.02,6]nonane-3,5-dione
4-methyl-2,4,6-triazatricyclo[5.1.1.02,6]nonane-3,5-dione (PubChem CID 12754518) has the molecular formula C7H9N3O2
and a molecular weight of 167.17 g/mol. Its IUPAC name is 4-methyl-2,4,6-triazatricyclo[5.1.1.02,6]nonane-3,5-dione.
Analyze 4-methyl-2,4,6-triazatricyclo[5.1.1.02,6]nonane-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,4,6-triazatricyclo[5.1.1.02,6]nonane-3,5-dione?
The IUPAC name of 4-methyl-2,4,6-triazatricyclo[5.1.1.02,6]nonane-3,5-dione (CID 12754518) is 4-methyl-2,4,6-triazatricyclo[5.1.1.02,6]nonane-3,5-dione.
What is the SMILES notation for 4-methyl-2,4,6-triazatricyclo[5.1.1.02,6]nonane-3,5-dione?
The canonical SMILES for 4-methyl-2,4,6-triazatricyclo[5.1.1.02,6]nonane-3,5-dione is Cn1c(=O)n2n(c1=O)C1CC2C1.
What is the InChIKey of 4-methyl-2,4,6-triazatricyclo[5.1.1.02,6]nonane-3,5-dione?
The InChIKey is ROEPEXAHURTRES-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O2/c1-8-6(11)9-4-2-5(3-4)10(9)7(8)12/h4-5H,2-3H2,1H3.
What are the key properties of 4-methyl-2,4,6-triazatricyclo[5.1.1.02,6]nonane-3,5-dione?
4-methyl-2,4,6-triazatricyclo[5.1.1.02,6]nonane-3,5-dione has a molecular weight of 167.17 g/mol, XLogP of -0.76, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,4,6-triazatricyclo[5.1.1.02,6]nonane-3,5-dione is sourced from PubChem (CID 12754518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).