About (6E)-6-(hydroxymethylidene)-2-phenyl-4,5-dihydro-1,3-benzothiazol-7-one
(6E)-6-(hydroxymethylidene)-2-phenyl-4,5-dihydro-1,3-benzothiazol-7-one (PubChem CID 12755130) has the molecular formula C14H11NO2S
and a molecular weight of 257.31 g/mol. Its IUPAC name is (6E)-6-(hydroxymethylidene)-2-phenyl-4,5-dihydro-1,3-benzothiazol-7-one.
Molecular Properties
| Compound Name | (6E)-6-(hydroxymethylidene)-2-phenyl-4,5-dihydro-1,3-benzothiazol-7-one |
| PubChem CID | 12755130 |
| Molecular Formula | C14H11NO2S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | (6E)-6-(hydroxymethylidene)-2-phenyl-4,5-dihydro-1,3-benzothiazol-7-one |
| SMILES | O=C1/C(=C/O)CCc2nc(-c3ccccc3)sc21 |
| InChI | InChI=1S/C14H11NO2S/c16-8-10-6-7-11-13(12(10)17)18-14(15-11)9-4-2-1-3-5-9/h1-5,8,16H,6-7H2/b10-8+ |
| InChIKey | MAIPINQTJHSIIV-CSKARUKUSA-N |
| XLogP | 3.38 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (6E)-6-(hydroxymethylidene)-2-phenyl-4,5-dihydro-1,3-benzothiazol-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-6-(hydroxymethylidene)-2-phenyl-4,5-dihydro-1,3-benzothiazol-7-one?
The IUPAC name of (6E)-6-(hydroxymethylidene)-2-phenyl-4,5-dihydro-1,3-benzothiazol-7-one (CID 12755130) is (6E)-6-(hydroxymethylidene)-2-phenyl-4,5-dihydro-1,3-benzothiazol-7-one.
What is the SMILES notation for (6E)-6-(hydroxymethylidene)-2-phenyl-4,5-dihydro-1,3-benzothiazol-7-one?
The canonical SMILES for (6E)-6-(hydroxymethylidene)-2-phenyl-4,5-dihydro-1,3-benzothiazol-7-one is O=C1/C(=C/O)CCc2nc(-c3ccccc3)sc21.
What is the InChIKey of (6E)-6-(hydroxymethylidene)-2-phenyl-4,5-dihydro-1,3-benzothiazol-7-one?
The InChIKey is MAIPINQTJHSIIV-CSKARUKUSA-N. The full InChI is InChI=1S/C14H11NO2S/c16-8-10-6-7-11-13(12(10)17)18-14(15-11)9-4-2-1-3-5-9/h1-5,8,16H,6-7H2/b10-8+.
What are the key properties of (6E)-6-(hydroxymethylidene)-2-phenyl-4,5-dihydro-1,3-benzothiazol-7-one?
(6E)-6-(hydroxymethylidene)-2-phenyl-4,5-dihydro-1,3-benzothiazol-7-one has a molecular weight of 257.31 g/mol, XLogP of 3.38, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-6-(hydroxymethylidene)-2-phenyl-4,5-dihydro-1,3-benzothiazol-7-one is sourced from PubChem (CID 12755130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).