About (E)-3-fluorohex-3-ene
(E)-3-fluorohex-3-ene (PubChem CID 12756890) has the molecular formula C6H11F
and a molecular weight of 102.15 g/mol. Its IUPAC name is (E)-3-fluorohex-3-ene.
Molecular Properties
| Compound Name | (E)-3-fluorohex-3-ene |
| PubChem CID | 12756890 |
| Molecular Formula | C6H11F |
| Molecular Weight | 102.15 g/mol |
| Exact Mass | 102.08 |
| IUPAC Name | (E)-3-fluorohex-3-ene |
| SMILES | CC/C=C(/F)CC |
| InChI | InChI=1S/C6H11F/c1-3-5-6(7)4-2/h5H,3-4H2,1-2H3/b6-5+ |
| InChIKey | IMSKCQSWQHRTGF-AATRIKPKSA-N |
| XLogP | 2.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.15 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (E)-3-fluorohex-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-fluorohex-3-ene?
The IUPAC name of (E)-3-fluorohex-3-ene (CID 12756890) is (E)-3-fluorohex-3-ene.
What is the SMILES notation for (E)-3-fluorohex-3-ene?
The canonical SMILES for (E)-3-fluorohex-3-ene is CC/C=C(/F)CC.
What is the InChIKey of (E)-3-fluorohex-3-ene?
The InChIKey is IMSKCQSWQHRTGF-AATRIKPKSA-N. The full InChI is InChI=1S/C6H11F/c1-3-5-6(7)4-2/h5H,3-4H2,1-2H3/b6-5+.
What are the key properties of (E)-3-fluorohex-3-ene?
(E)-3-fluorohex-3-ene has a molecular weight of 102.15 g/mol, XLogP of 2.66, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-fluorohex-3-ene is sourced from PubChem (CID 12756890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).