C11H13F7O2 — CID 12756975
7-ethyl-1,1,1,2,2,3,3-heptafluorononane-4,6-dione (PubChem CID 12756975) has the molecular formula C11H13F7O2 and a molecular weight of 310.21 g/mol. Its IUPAC name is 7-ethyl-1,1,1,2,2,3,3-heptafluorononane-4,6-dione.
| Compound Name | 7-ethyl-1,1,1,2,2,3,3-heptafluorononane-4,6-dione |
|---|---|
| PubChem CID | 12756975 |
| Molecular Formula | C11H13F7O2 |
| Molecular Weight | 310.21 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 7-ethyl-1,1,1,2,2,3,3-heptafluorononane-4,6-dione |
| SMILES | CCC(CC)C(=O)CC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H13F7O2/c1-3-6(4-2)7(19)5-8(20)9(12,13)10(14,15)11(16,17)18/h6H,3-5H2,1-2H3 |
| InChIKey | NOSIICKOBIURRM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.21 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|