C17H16N4O2 — CID 12757361
N,N-dimethyl-4,6-diphenoxy-1,3,5-triazin-2-amine (PubChem CID 12757361) has the molecular formula C17H16N4O2 and a molecular weight of 308.34 g/mol. Its IUPAC name is N,N-dimethyl-4,6-diphenoxy-1,3,5-triazin-2-amine.
| Compound Name | N,N-dimethyl-4,6-diphenoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 12757361 |
| Molecular Formula | C17H16N4O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | N,N-dimethyl-4,6-diphenoxy-1,3,5-triazin-2-amine |
| SMILES | CN(C)c1nc(Oc2ccccc2)nc(Oc2ccccc2)n1 |
| InChI | InChI=1S/C17H16N4O2/c1-21(2)15-18-16(22-13-9-5-3-6-10-13)20-17(19-15)23-14-11-7-4-8-12-14/h3-12H,1-2H3 |
| InChIKey | OKPWNAXUCFURDC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |