C7H10F5O3P — CID 12757471
2-diethoxyphosphoryl-1,1,3,3,3-pentafluoroprop-1-ene (PubChem CID 12757471) has the molecular formula C7H10F5O3P and a molecular weight of 268.12 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-1,1,3,3,3-pentafluoroprop-1-ene.
| Compound Name | 2-diethoxyphosphoryl-1,1,3,3,3-pentafluoroprop-1-ene |
|---|---|
| PubChem CID | 12757471 |
| Molecular Formula | C7H10F5O3P |
| Molecular Weight | 268.12 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 2-diethoxyphosphoryl-1,1,3,3,3-pentafluoroprop-1-ene |
| SMILES | CCOP(=O)(OCC)C(=C(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H10F5O3P/c1-3-14-16(13,15-4-2)5(6(8)9)7(10,11)12/h3-4H2,1-2H3 |
| InChIKey | LQXJKTIACUSKSH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.12 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|