About 2-diethoxyphosphoryl-1,1,1-trifluoro-2-(trifluoromethyl)butane
2-diethoxyphosphoryl-1,1,1-trifluoro-2-(trifluoromethyl)butane (PubChem CID 12757472) has the molecular formula C9H15F6O3P
and a molecular weight of 316.18 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-1,1,1-trifluoro-2-(trifluoromethyl)butane.
Molecular Properties
| Compound Name | 2-diethoxyphosphoryl-1,1,1-trifluoro-2-(trifluoromethyl)butane |
| PubChem CID | 12757472 |
| Molecular Formula | C9H15F6O3P |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 2-diethoxyphosphoryl-1,1,1-trifluoro-2-(trifluoromethyl)butane |
| SMILES | CCOP(=O)(OCC)C(CC)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H15F6O3P/c1-4-7(8(10,11)12,9(13,14)15)19(16,17-5-2)18-6-3/h4-6H2,1-3H3 |
| InChIKey | JXGGXYFVIYDDMX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-diethoxyphosphoryl-1,1,1-trifluoro-2-(trifluoromethyl)butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diethoxyphosphoryl-1,1,1-trifluoro-2-(trifluoromethyl)butane?
The IUPAC name of 2-diethoxyphosphoryl-1,1,1-trifluoro-2-(trifluoromethyl)butane (CID 12757472) is 2-diethoxyphosphoryl-1,1,1-trifluoro-2-(trifluoromethyl)butane.
What is the SMILES notation for 2-diethoxyphosphoryl-1,1,1-trifluoro-2-(trifluoromethyl)butane?
The canonical SMILES for 2-diethoxyphosphoryl-1,1,1-trifluoro-2-(trifluoromethyl)butane is CCOP(=O)(OCC)C(CC)(C(F)(F)F)C(F)(F)F.
What is the InChIKey of 2-diethoxyphosphoryl-1,1,1-trifluoro-2-(trifluoromethyl)butane?
The InChIKey is JXGGXYFVIYDDMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F6O3P/c1-4-7(8(10,11)12,9(13,14)15)19(16,17-5-2)18-6-3/h4-6H2,1-3H3.
What are the key properties of 2-diethoxyphosphoryl-1,1,1-trifluoro-2-(trifluoromethyl)butane?
2-diethoxyphosphoryl-1,1,1-trifluoro-2-(trifluoromethyl)butane has a molecular weight of 316.18 g/mol, XLogP of 4.53, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diethoxyphosphoryl-1,1,1-trifluoro-2-(trifluoromethyl)butane is sourced from PubChem (CID 12757472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).