About 2,3,4,5-tetradeuteriopyridine
2,3,4,5-tetradeuteriopyridine (PubChem CID 12757484) has the molecular formula C5H5N
and a molecular weight of 83.13 g/mol. Its IUPAC name is 2,3,4,5-tetradeuteriopyridine.
Molecular Properties
| Compound Name | 2,3,4,5-tetradeuteriopyridine |
| PubChem CID | 12757484 |
| Molecular Formula | C5H5N |
| Molecular Weight | 83.13 g/mol |
| Exact Mass | 83.07 |
| IUPAC Name | 2,3,4,5-tetradeuteriopyridine |
| SMILES | [2H]c1cnc([2H])c([2H])c1[2H] |
| InChI | InChI=1S/C5H5N/c1-2-4-6-5-3-1/h1-5H/i1D,2D,3D,4D |
| InChIKey | JUJWROOIHBZHMG-RHQRLBAQSA-N |
| XLogP | 1.08 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 83.13 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3,4,5-tetradeuteriopyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4,5-tetradeuteriopyridine?
The IUPAC name of 2,3,4,5-tetradeuteriopyridine (CID 12757484) is 2,3,4,5-tetradeuteriopyridine.
What is the SMILES notation for 2,3,4,5-tetradeuteriopyridine?
The canonical SMILES for 2,3,4,5-tetradeuteriopyridine is [2H]c1cnc([2H])c([2H])c1[2H].
What is the InChIKey of 2,3,4,5-tetradeuteriopyridine?
The InChIKey is JUJWROOIHBZHMG-RHQRLBAQSA-N. The full InChI is InChI=1S/C5H5N/c1-2-4-6-5-3-1/h1-5H/i1D,2D,3D,4D.
What are the key properties of 2,3,4,5-tetradeuteriopyridine?
2,3,4,5-tetradeuteriopyridine has a molecular weight of 83.13 g/mol, XLogP of 1.08, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4,5-tetradeuteriopyridine is sourced from PubChem (CID 12757484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).