About 2-benzoyl-9-benzyl-1-methyl-3,4-dihydropyrido[3,4-b]indole-1-carbonitrile
2-benzoyl-9-benzyl-1-methyl-3,4-dihydropyrido[3,4-b]indole-1-carbonitrile (PubChem CID 12759034) has the molecular formula C27H23N3O
and a molecular weight of 405.50 g/mol. Its IUPAC name is 2-benzoyl-9-benzyl-1-methyl-3,4-dihydropyrido[3,4-b]indole-1-carbonitrile.
Molecular Properties
| Compound Name | 2-benzoyl-9-benzyl-1-methyl-3,4-dihydropyrido[3,4-b]indole-1-carbonitrile |
| PubChem CID | 12759034 |
| Molecular Formula | C27H23N3O |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 2-benzoyl-9-benzyl-1-methyl-3,4-dihydropyrido[3,4-b]indole-1-carbonitrile |
| SMILES | CC1(C#N)c2c(c3ccccc3n2Cc2ccccc2)CCN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C27H23N3O/c1-27(19-28)25-23(16-17-30(27)26(31)21-12-6-3-7-13-21)22-14-8-9-15-24(22)29(25)18-20-10-4-2-5-11-20/h2-15H,16-18H2,1H3 |
| InChIKey | UTLRBAHVOAFNSH-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 49.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-benzoyl-9-benzyl-1-methyl-3,4-dihydropyrido[3,4-b]indole-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzoyl-9-benzyl-1-methyl-3,4-dihydropyrido[3,4-b]indole-1-carbonitrile?
The IUPAC name of 2-benzoyl-9-benzyl-1-methyl-3,4-dihydropyrido[3,4-b]indole-1-carbonitrile (CID 12759034) is 2-benzoyl-9-benzyl-1-methyl-3,4-dihydropyrido[3,4-b]indole-1-carbonitrile.
What is the SMILES notation for 2-benzoyl-9-benzyl-1-methyl-3,4-dihydropyrido[3,4-b]indole-1-carbonitrile?
The canonical SMILES for 2-benzoyl-9-benzyl-1-methyl-3,4-dihydropyrido[3,4-b]indole-1-carbonitrile is CC1(C#N)c2c(c3ccccc3n2Cc2ccccc2)CCN1C(=O)c1ccccc1.
What is the InChIKey of 2-benzoyl-9-benzyl-1-methyl-3,4-dihydropyrido[3,4-b]indole-1-carbonitrile?
The InChIKey is UTLRBAHVOAFNSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H23N3O/c1-27(19-28)25-23(16-17-30(27)26(31)21-12-6-3-7-13-21)22-14-8-9-15-24(22)29(25)18-20-10-4-2-5-11-20/h2-15H,16-18H2,1H3.
What are the key properties of 2-benzoyl-9-benzyl-1-methyl-3,4-dihydropyrido[3,4-b]indole-1-carbonitrile?
2-benzoyl-9-benzyl-1-methyl-3,4-dihydropyrido[3,4-b]indole-1-carbonitrile has a molecular weight of 405.50 g/mol, XLogP of 5.13, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzoyl-9-benzyl-1-methyl-3,4-dihydropyrido[3,4-b]indole-1-carbonitrile is sourced from PubChem (CID 12759034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).