C22H18N6 — CID 1275920
5,9-diamino-7,10-diphenyl-1,4-diazatricyclo[5.2.1.04,10]deca-5,8-diene-6,8-dicarbonitrile (PubChem CID 1275920) has the molecular formula C22H18N6 and a molecular weight of 366.43 g/mol. Its IUPAC name is 5,9-diamino-7,10-diphenyl-1,4-diazatricyclo[5.2.1.04,10]deca-5,8-diene-6,8-dicarbonitrile.
| Compound Name | 5,9-diamino-7,10-diphenyl-1,4-diazatricyclo[5.2.1.04,10]deca-5,8-diene-6,8-dicarbonitrile |
|---|---|
| PubChem CID | 1275920 |
| Molecular Formula | C22H18N6 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 5,9-diamino-7,10-diphenyl-1,4-diazatricyclo[5.2.1.04,10]deca-5,8-diene-6,8-dicarbonitrile |
| SMILES | N#CC1=C(N)N2CCN3C(N)=C(C#N)C1(c1ccccc1)C23c1ccccc1 |
| InChI | InChI=1S/C22H18N6/c23-13-17-19(25)27-11-12-28-20(26)18(14-24)21(17,15-7-3-1-4-8-15)22(27,28)16-9-5-2-6-10-16/h1-10H,11-12,25-26H2 |
| InChIKey | GBDWIENVDYYIFR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 106.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |