C13H23N3O — CID 127595707
3-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)piperidin-2-one (PubChem CID 127595707) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is 3-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)piperidin-2-one.
| Compound Name | 3-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)piperidin-2-one |
|---|---|
| PubChem CID | 127595707 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 3-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)piperidin-2-one |
| SMILES | O=C1NCCCC1N1CCN2CCCCC2C1 |
| InChI | InChI=1S/C13H23N3O/c17-13-12(5-3-6-14-13)16-9-8-15-7-2-1-4-11(15)10-16/h11-12H,1-10H2,(H,14,17) |
| InChIKey | VNCACTFVHSAODZ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |