About 3-benzylthiane
3-benzylthiane (PubChem CID 12759730) has the molecular formula C12H16S
and a molecular weight of 192.33 g/mol. Its IUPAC name is 3-benzylthiane.
Molecular Properties
| Compound Name | 3-benzylthiane |
| PubChem CID | 12759730 |
| Molecular Formula | C12H16S |
| Molecular Weight | 192.33 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 3-benzylthiane |
| SMILES | c1ccc(CC2CCCSC2)cc1 |
| InChI | InChI=1S/C12H16S/c1-2-5-11(6-3-1)9-12-7-4-8-13-10-12/h1-3,5-6,12H,4,7-10H2 |
| InChIKey | QVSZXDRPMGJIBR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-benzylthiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzylthiane?
The IUPAC name of 3-benzylthiane (CID 12759730) is 3-benzylthiane.
What is the SMILES notation for 3-benzylthiane?
The canonical SMILES for 3-benzylthiane is c1ccc(CC2CCCSC2)cc1.
What is the InChIKey of 3-benzylthiane?
The InChIKey is QVSZXDRPMGJIBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16S/c1-2-5-11(6-3-1)9-12-7-4-8-13-10-12/h1-3,5-6,12H,4,7-10H2.
What are the key properties of 3-benzylthiane?
3-benzylthiane has a molecular weight of 192.33 g/mol, XLogP of 3.37, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzylthiane is sourced from PubChem (CID 12759730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).