C15H21BrFNO — CID 12760511
2-bromo-N-[2-(4-fluorophenyl)propan-2-yl]-3,3-dimethylbutanamide (PubChem CID 12760511) has the molecular formula C15H21BrFNO and a molecular weight of 330.24 g/mol. Its IUPAC name is 2-bromo-N-[2-(4-fluorophenyl)propan-2-yl]-3,3-dimethylbutanamide.
| Compound Name | 2-bromo-N-[2-(4-fluorophenyl)propan-2-yl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 12760511 |
| Molecular Formula | C15H21BrFNO |
| Molecular Weight | 330.24 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 2-bromo-N-[2-(4-fluorophenyl)propan-2-yl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(NC(=O)C(Br)C(C)(C)C)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H21BrFNO/c1-14(2,3)12(16)13(19)18-15(4,5)10-6-8-11(17)9-7-10/h6-9,12H,1-5H3,(H,18,19) |
| InChIKey | AJBZJOLOZCKPSG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.24 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|