About 3-cyclohexyloxy-1H-1,2,4-triazol-5-amine
3-cyclohexyloxy-1H-1,2,4-triazol-5-amine (PubChem CID 12760729) has the molecular formula C8H14N4O
and a molecular weight of 182.23 g/mol. Its IUPAC name is 3-cyclohexyloxy-1H-1,2,4-triazol-5-amine.
Molecular Properties
| Compound Name | 3-cyclohexyloxy-1H-1,2,4-triazol-5-amine |
| PubChem CID | 12760729 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 3-cyclohexyloxy-1H-1,2,4-triazol-5-amine |
| SMILES | Nc1nc(OC2CCCCC2)n[nH]1 |
| InChI | InChI=1S/C8H14N4O/c9-7-10-8(12-11-7)13-6-4-2-1-3-5-6/h6H,1-5H2,(H3,9,10,11,12) |
| InChIKey | CISJMBDPEAXZFA-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-cyclohexyloxy-1H-1,2,4-triazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyloxy-1H-1,2,4-triazol-5-amine?
The IUPAC name of 3-cyclohexyloxy-1H-1,2,4-triazol-5-amine (CID 12760729) is 3-cyclohexyloxy-1H-1,2,4-triazol-5-amine.
What is the SMILES notation for 3-cyclohexyloxy-1H-1,2,4-triazol-5-amine?
The canonical SMILES for 3-cyclohexyloxy-1H-1,2,4-triazol-5-amine is Nc1nc(OC2CCCCC2)n[nH]1.
What is the InChIKey of 3-cyclohexyloxy-1H-1,2,4-triazol-5-amine?
The InChIKey is CISJMBDPEAXZFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4O/c9-7-10-8(12-11-7)13-6-4-2-1-3-5-6/h6H,1-5H2,(H3,9,10,11,12).
What are the key properties of 3-cyclohexyloxy-1H-1,2,4-triazol-5-amine?
3-cyclohexyloxy-1H-1,2,4-triazol-5-amine has a molecular weight of 182.23 g/mol, XLogP of 1.10, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyloxy-1H-1,2,4-triazol-5-amine is sourced from PubChem (CID 12760729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).