About 1-[(2E)-3,7-dimethylocta-2,6-dienyl]piperidine
1-[(2E)-3,7-dimethylocta-2,6-dienyl]piperidine (PubChem CID 12760939) has the molecular formula C15H27N
and a molecular weight of 221.39 g/mol. Its IUPAC name is 1-[(2E)-3,7-dimethylocta-2,6-dienyl]piperidine.
Molecular Properties
| Compound Name | 1-[(2E)-3,7-dimethylocta-2,6-dienyl]piperidine |
| PubChem CID | 12760939 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | 1-[(2E)-3,7-dimethylocta-2,6-dienyl]piperidine |
| SMILES | CC(C)=CCC/C(C)=C/CN1CCCCC1 |
| InChI | InChI=1S/C15H27N/c1-14(2)8-7-9-15(3)10-13-16-11-5-4-6-12-16/h8,10H,4-7,9,11-13H2,1-3H3/b15-10+ |
| InChIKey | DKUCHUIKIVUQEN-XNTDXEJSSA-N |
| XLogP | 4.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2E)-3,7-dimethylocta-2,6-dienyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2E)-3,7-dimethylocta-2,6-dienyl]piperidine?
The IUPAC name of 1-[(2E)-3,7-dimethylocta-2,6-dienyl]piperidine (CID 12760939) is 1-[(2E)-3,7-dimethylocta-2,6-dienyl]piperidine.
What is the SMILES notation for 1-[(2E)-3,7-dimethylocta-2,6-dienyl]piperidine?
The canonical SMILES for 1-[(2E)-3,7-dimethylocta-2,6-dienyl]piperidine is CC(C)=CCC/C(C)=C/CN1CCCCC1.
What is the InChIKey of 1-[(2E)-3,7-dimethylocta-2,6-dienyl]piperidine?
The InChIKey is DKUCHUIKIVUQEN-XNTDXEJSSA-N. The full InChI is InChI=1S/C15H27N/c1-14(2)8-7-9-15(3)10-13-16-11-5-4-6-12-16/h8,10H,4-7,9,11-13H2,1-3H3/b15-10+.
What are the key properties of 1-[(2E)-3,7-dimethylocta-2,6-dienyl]piperidine?
1-[(2E)-3,7-dimethylocta-2,6-dienyl]piperidine has a molecular weight of 221.39 g/mol, XLogP of 4.16, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2E)-3,7-dimethylocta-2,6-dienyl]piperidine is sourced from PubChem (CID 12760939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).