C11H12N6 — CID 12761313
N,N,7-trimethyl-2,4,6,8,13-pentazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9,11-hexaen-3-amine (PubChem CID 12761313) has the molecular formula C11H12N6 and a molecular weight of 228.26 g/mol. Its IUPAC name is N,N,7-trimethyl-2,4,6,8,13-pentazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9,11-hexaen-3-amine.
| Compound Name | N,N,7-trimethyl-2,4,6,8,13-pentazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9,11-hexaen-3-amine |
|---|---|
| PubChem CID | 12761313 |
| Molecular Formula | C11H12N6 |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | N,N,7-trimethyl-2,4,6,8,13-pentazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9,11-hexaen-3-amine |
| SMILES | CC1=NC2=CC=CC3=NC(N(C)C)=NC(=N1)N23 |
| InChI | InChI=1S/C11H12N6/c1-7-12-8-5-4-6-9-14-10(16(2)3)15-11(13-7)17(8)9/h4-6H,1-3H3 |
| InChIKey | DCVDDLYIMFHSHE-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 55.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |