C14H16N6 — CID 12761316
3-methyl-7-piperidin-1-yl-2,4,6,8,13-pentazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9,11-hexaene (PubChem CID 12761316) has the molecular formula C14H16N6 and a molecular weight of 268.32 g/mol. Its IUPAC name is 3-methyl-7-piperidin-1-yl-2,4,6,8,13-pentazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9,11-hexaene.
| Compound Name | 3-methyl-7-piperidin-1-yl-2,4,6,8,13-pentazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9,11-hexaene |
|---|---|
| PubChem CID | 12761316 |
| Molecular Formula | C14H16N6 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 3-methyl-7-piperidin-1-yl-2,4,6,8,13-pentazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9,11-hexaene |
| SMILES | CC1=NC2=NC(N3CCCCC3)=NC3=CC=CC(=N1)N32 |
| InChI | InChI=1S/C14H16N6/c1-10-15-11-6-5-7-12-17-13(18-14(16-10)20(11)12)19-8-3-2-4-9-19/h5-7H,2-4,8-9H2,1H3 |
| InChIKey | UAUSWGIWSLQMJB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 55.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |