About ethyl 2-(10,10-dioxo-9H-thioxanthen-9-yl)-3-oxobutanoate
ethyl 2-(10,10-dioxo-9H-thioxanthen-9-yl)-3-oxobutanoate (PubChem CID 12761423) has the molecular formula C19H18O5S
and a molecular weight of 358.42 g/mol. Its IUPAC name is ethyl 2-(10,10-dioxo-9H-thioxanthen-9-yl)-3-oxobutanoate.
Molecular Properties
| Compound Name | ethyl 2-(10,10-dioxo-9H-thioxanthen-9-yl)-3-oxobutanoate |
| PubChem CID | 12761423 |
| Molecular Formula | C19H18O5S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | ethyl 2-(10,10-dioxo-9H-thioxanthen-9-yl)-3-oxobutanoate |
| SMILES | CCOC(=O)C(C(C)=O)C1c2ccccc2S(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C19H18O5S/c1-3-24-19(21)17(12(2)20)18-13-8-4-6-10-15(13)25(22,23)16-11-7-5-9-14(16)18/h4-11,17-18H,3H2,1-2H3 |
| InChIKey | AAFLUWFBOBIADR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(10,10-dioxo-9H-thioxanthen-9-yl)-3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(10,10-dioxo-9H-thioxanthen-9-yl)-3-oxobutanoate?
The IUPAC name of ethyl 2-(10,10-dioxo-9H-thioxanthen-9-yl)-3-oxobutanoate (CID 12761423) is ethyl 2-(10,10-dioxo-9H-thioxanthen-9-yl)-3-oxobutanoate.
What is the SMILES notation for ethyl 2-(10,10-dioxo-9H-thioxanthen-9-yl)-3-oxobutanoate?
The canonical SMILES for ethyl 2-(10,10-dioxo-9H-thioxanthen-9-yl)-3-oxobutanoate is CCOC(=O)C(C(C)=O)C1c2ccccc2S(=O)(=O)c2ccccc21.
What is the InChIKey of ethyl 2-(10,10-dioxo-9H-thioxanthen-9-yl)-3-oxobutanoate?
The InChIKey is AAFLUWFBOBIADR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18O5S/c1-3-24-19(21)17(12(2)20)18-13-8-4-6-10-15(13)25(22,23)16-11-7-5-9-14(16)18/h4-11,17-18H,3H2,1-2H3.
What are the key properties of ethyl 2-(10,10-dioxo-9H-thioxanthen-9-yl)-3-oxobutanoate?
ethyl 2-(10,10-dioxo-9H-thioxanthen-9-yl)-3-oxobutanoate has a molecular weight of 358.42 g/mol, XLogP of 2.73, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(10,10-dioxo-9H-thioxanthen-9-yl)-3-oxobutanoate is sourced from PubChem (CID 12761423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).